in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. B. Pahom is unhappy. This answer has been confirmed as correct and helpful. Write 0.005483 correct to 2 significant figures. What must be true of an object that has gravitational potential energy? This is the nature of thermal energy. Click here to get an answer to your question Thermal energy depends on an object's A. mass. What does this mean in terms of electricity and food? On december 31, a physical inventory revealed that the ending inventory was only $210,000. What is the difference between heat, temperature and thermal energy? Is food energy potential or kinetic energy? Study with Quizlet and memorize flashcards containing terms like Forces that are equal in size but opposite in direction are called unbalanced forces. The more mass an object has, the more particles are in the sample and the more thermal energy it will have at the same temperature. How to convert calories to joules with a formula. The answer was double-checked by an expert and found to be incorrect. an appraisal determined that 25% of the total cost was a 13. the amount earned (in dollars) for recycling p poundsof copper is 2p. A fast-food item contains 544 nutritional calories. Use the kinetic theory to explain thermal expansion. D. Pahom dies. What are two units of measure for energy? What are 5 similarities between guidance and counseling. Weegy: Biblio in the word bibliographies is a root word that Weegy: Most Americans believe a corporation s top obligation is to its EMPLOYEES. Weegy: 0.005483 in 2 significant figure is 0.01. A 2 kg slab is dragged along a rough surface through a distance of 12 m. If the magnitude of kinetic frictional force between the slab and the rough surface is 3 N, what is the increase in thermal energy? Air in a balloon does 27 J of work while absorbing 75 J of heat. What is the mood and tone for the tale of tonyo the brave? All of the above. Temperature is a relative measure of: a. internal energy b. specific heat c. hotness d. transferred energy. When does an object possess mechanical energy? hope this ! A 5.75 Kg object passes through the origin at time t = 0 such that its x component of velocity is 5.00 m/s and its y component of velocity is 3.00 m/s. Does an object with energy always have momentum? In terms of energy, what does "work" mean? Confirmed by selymi [12/9/2015 3:56:00 AM] Comments. Thermal Energy depends on an object's? What is the proper unit for gravitational potential energy? Which describes the energy in this system? 20 19. which part of the expression is a quotient? Which of the following people is most likely to be destitute? Most people would say they can measure how cold or hot something is by its temperature. On what factors does the weight of an object depend? - Definition & Examples. D. light-emitting diodes. Explain and give an example of both thermal energy and temperature. C. filament. The first law of thermodynamic apply to: heating objects, transferring thermal energy, doing work on a system. See how thermal energy works and what type of energy it is classified as. Views. a. Thermal energy depends on an objects In the formula which quantity represents the specific heat? when true-breeding long-haired animals were crossed to true-breeding short-haired anim 18. in 19 and 20, use the expression 5.3t - (20 + 4) + 11. B. phase (sold, liquid, or gas). A. assailed Answer and Explanation: 1. meanings. Added 11/4/2014 6:09:06 PM. Thermal energy depends on an object's mass, phase (sold, liquid, or gas) and temperature. Which best describes what is causing this change: work, power, gravitational energy, or chemical energy? (Answer in J). Create your account. the same temperature. A. a vacuum. All posts tagged in: thermal energy depends on an object's. blog. Which of the following sentences from "How Much Land Does a Man Need?" g f , Acetic acid /sitk/, systematically named ethanoic acid /nok/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). How would you calculate an object's mechanical energy? Thermal energy depends on an object's what? B. recurred a. c-i b. c-br c. c-cl d. c-f e. c-o, Computers and Technology, 05.12.2019 06:31, And millions of other answers 4U without ads. What can you say about the characters in bantay and tagpi story? The way people think of heat as an energy source is so complex that it has to balance out. the ratio of the mass of neptune to that of uranus is 1.19. the ratio of the radius of neptune to that of uranus is 0.969. find the average density of neptune. Added 8/16/2019 7:16:20 AM This answer has been confirmed as correct and helpful. How do you convert this energy to joules? B. shows emotion. D. all of What electrical unit is equivalent to one Joule? The instantaneous velocity of an object is what? What units are used to measure sound energy? A teacher walks into the Classroom and says If only Yesterday was Tomorrow Today would have been a Saturday Which Day did the Teacher make this Statement? the building cost $2 million. be no thermal energy transfer. .. December 29, 2021. Describe how an insulator can slow a transfer of energy. below represents a factor between 1 and 9. draw lines to match each fact on the left with a pattern for its products on the ri View a few ads and unblock the answer on the site. Can heat be kinetic energy and potential energy? Thermal Energy depends on an object's: Mass, Phase (sold, liquid, or gas), temperature. Unlike kinetic energy, potential energy is, Heat transfer within a fluid takes place by. when undiluted, it is sometimes called glacial acetic acid. What property of matter is momentum related to? a) The average kinetic energy of the particles in the mug decreases. This answer has been confirmed as correct and helpful. A. mass. 1. with the advent of the railroad, people could cross the state by rail in a little over 24 hours. What are some physical symptoms of stress? A thermometer measures temperature, but what is being measured by that thermometer? What would be an example of something that doesn't have potential energy? b. phase (sold, liquid, or gas). Yes.Since temperature is the average kinetic energy of all of the particles (i.e., thermal energy/mass) and thermal energy is the total, two objects of different mass and different internal . How much heat energy is needed to raise the temperature of 2.08 kg of this oil from 23 C to 191 C? Question|Asked by xxhighwolfxx. Our experts can answer your tough homework and study questions. A. Pahom buys a farm. D. convergent. Thermal energy depends on an objects mass, phase (sold, liquid, or gas) and temperature. Both samples of water were at the same temperature, so the only difference was the mass of the water. We advise you to submit this question to subject matter expert for a step-by-step solution in less than 15 minutes for FREE. At what height is an object that weighs 490 N if its gravitational potential energy is 4900 N.m? Which one of the following statements is true? An incandescent light bulb produces light when electrons flow through the Filament. How are potential energy, kinetic energy, and total energy related? Thermal energy depends on an object's: Temp, mass, and phase. User: The idea that corporations Weegy: If you measure the impact you have on the environment, you are measuring your carbon footprint. What is the rate of energy transferred called? Weegy: Biblio in the word bibliographies is a root word that Weegy: Most Americans believe a corporation s top obligation is to its EMPLOYEES. An incandescent light bulb produces light when electrons flow through the It seems to me that the energy of both is from fast-moving particles. What is the difference between kinetic energy (KE) and potential energy (PE)? b) The average kinetic energy of the particles in the coffee increases. f. Get an answer. What factors determine the gravitational potential energy of an object? C. temperature. The specific heat of a certain type of cooking oil is 1.75 J/(g*K). What are some physical symptoms of stress? Its: all of the above. What is the formula for potential energy? Its: all of the above. A fluorescent light tube usually contains 3.500 J/g^{\circ}C c. 15.6 J/g^{\circ}C d. 4.184 J/g^{\circ}C. What is the major distinction between thermal energy and radiant energy? What determines the average kinetic energy of the molecules of any gas? Updated 8/16/2019 7:16:20 AM. generatifb. B) internal energy increases. All rights reserved. D. all of the above. Its: all of the above. What is the unit of electrical potential energy? It depends on the object's mass and temperature. Get access to this video and our entire Q&A library, What is Thermal Energy? How much energy would be generated if a physics student (mass = 62 kg) could be completely turned into energy? When a spring is compressed, the energy changes from kinetic to potential. what scale factor was used? Asked 4/12/2017 10:38:30 AM. The words HOSTILE and HOSPITABLE have ? What happens to an object as its kinetic energy increases? What does the kinetic theory state about the kinetic energy of gas molecules? pettys gross profit on net sales has remained constant at 15 points plz either use each of these nouns in a sentence which shows a human trait or characteristic or choose one noun and On january 1, 2016, vki corporation awarded restricted stock units (rsus) representing 12 million of its 81 par commonshares to key personnel, subject 18. a particular breed of dog can have long hair or short hair. When we burn a hot metal, the heat escapes from our body, and we can't hold . true false 1. after collecting data, ron determined that balance he was using was miscalibrated. Object A's specific heat is 2.45 J/g \cdot \^circ C and object B's specific heat is 0.82 J/g \cdot ^\circ C. Which object will heat up faster if they have the same mass and equal amount of heat is applied? What energy conversions take place in a pendulum? If an object's kinetic energy is zero, what is its momentum? C. mercury vapor. What is the best example of potential energy? To which of the following does the first law of thermodynamic apply? B. phase (sold, liquid, or gas). A. B. oxygen. meanings. Which would be hotter to the touch? Mass and velocity are the 2 factors used to calculate kinetic energy. Each CERT a person who is lactose intolerant would have difficulty digesting An imperative sentence A. makes a statement. Define the following terms as applied to thermal physics: a. specific heat capacity of a substance b. latent heat c. internal energy d. temperature. B. glass. What is the energy of an object because of its potential and kinetic energies? What makes something cold or hot? User: a person who is lactose intolerant WINDOWPANE is the live-streaming app for sharing your life as it happens, without filters, editing, or anything fake. What is the relationship between heat and thermal energy? Log in for more information. What is Substantive conditions of employment? Heat, like work, is an energy transfer measured in. Which law is designed to promote overall fairness in Federal personnel actions (Equal Employment Opportunity Laws page 7 of 19)? What happens to the energy of an object when the object slows down? Suppose an object possesses total energy of 100 J when held at a height 10 m, if the object is then released, how much Kinetic energy and Potential energy will the object have the height of 2 m?. A 10.1 kg object is picked up off the ground and placed on a shelf that is 0.84 m higher. temperature objects. 15. each ? All other trademarks and copyrights are the property of their respective owners. is it orange tree renewable or nonrenewable? C. temperature. To illustrate this point, suppose you had some boiling hot water at 100 degrees Celsius. Thermal Energy depends on an object's: Mass, Phase (sold, liquid, or gas), temperature. Thermal energy depends on an object's A mass B phase C temperature D all of the above? The momentum of an object depends on what two quantities? If you were to put one drop of this boiling hot water on the palm of your hand, the thermal energy would be transferred to your hand. B. shows emotion. D. all of the above 2 See answers Advertisement Advertisement SJ2006 SJ2006 D.) All of the above Advertisement Advertisement Brainly User Brainly User The answer would be d If a particle's speed increases by a factor of 5, by what factor does its kinetic energy change. A catalyst is a substance that increases the availability of energy. If a large bucket of the same boiling water were to be poured onto the palm of your hand, the thermal energy that would be transferred to your hand would cause pain and severe burns. _, If a net force acts on an object, the object may change speed, change direction or do neither., Balanced forces acting on an object cause the object to accelerate. is this a reduction or an enlargement? A farmer has 19 sheep All but 7 die How many are left? What would be the heat transfer between each object and the boy? A. What contributes to the internal energy of matter? What is the difference between potential and kinetic energy? Learn the definition of thermal energy with examples. he decides to take 19. square abcd was dilated to form square abcd. the thermal energy of both will remain constant as there would C. spectral A boy then touches both objects. Thermal energy depends on an object's mass, phase (sold, liquid, or gas) and temperature. Explain why. Mass measures the quantity of material in a sample of matter, thus the thermal energy depends on the mass and the temperature of the object being measured. c. The specific heat of copper is 0.385 J/gC. Thermal energy is a measurement of the total kinetic energy of the particles of a sample of matter. What do FIVE stars on a US Passport CARD Mean? "The heat in a hot object is the mechanical energy of its atoms and molecules in motion." What murder did Adam McVeay do in Fort Smith AR? (In other words, how much energy was added/taken away from the object.) Potential energy that depends on height is called. How much force is needed to lift an object 7 meters if it takes 300 joules of energy to get it there? contains a linking verb? What instrument is used to measure the average kinetic energy in a substance? What word is formed if you unscramble the letters ulmhpyot? A. a homeless man Which phase (solid, liquid, gas) of the same matter has the greatest amount of internal energy? Kinetic energy differs from chemical energy in that. What is thermal energy? Explain. D. a soldier at war, While serious areas of disagreement remain, our views are now more ________. and more. What is its change in internal energy? What does kinetic and potential energy depend on? This answer has been confirmed as correct and helpful. This conversation has been flagged as incorrect. The Anatomy of a Great black hills energy cheyenne wy. Road users moving into your lane, brake lights, and abrupt changes in road surface are a. rare at night b. indicators of potential hazards c. not worth worrying about before you reach them d. no problem for experienced drivers, Why are graphs useful when interpreting data. A. 30. Thermal energy depends on an object's A. mass. You will receive an answer to the email. B. a businesswoman If a solid object radiates more energy than it absorbs, its: A) temperature decreases. copyright 2003-2022 Homework.Study.com. how does the presence of a catalyst affect the activation energy of a reaction? Each CERT a person who is lactose intolerant would have difficulty digesting An imperative sentence A. makes a statement. The words HOSTILE and HOSPITABLE have ? Added 11/4/2014 6:09:06 PM. 14. What must be true about two objects for conduction to take place? acetic acid has a distinctive sour taste and pungent smell. Log in for more information. Answer: 2 on a question Thermal energy depends on an object's a. mass. What does the amount of enery a wave transmits depend on? 1 Answer/Comment. Thermal energy depends on two things, the temperature of the sample of matter and the quantity of material in that sample of matter. which equesion shows 1. reproduksi yang memungkinkan tumbuhan mewarisi semua karakteristik atau sifat hanya dari satu induk adalah reproduksi secaraa. Energy: Energy is a very broad term; there are many types. B. phase (sold, liquid, or gas). Weegy: 0.005483 in 2 significant figure is 0.01. what sort bias has he inadvertently introduced into 10. jon is deciding between a job with company a that pays $500 a week and a job with company b that pays $550 a week. What is the total mechanical energy of an object in a ciricular orbit? c) Thermal e. If a wave is measured at 0.4 m, what is its energy? Which one of the following statements is true? What kind of energy does friction produce? the equation for kinetic energy is (1/2)mv^2. C. an angry child User: You can Weegy: People who are lactose intolerant cannot digest the sugar in milk. An iron and plastic object of the same shape and size are placed under the sun, with a temperature of 34C. Weegy: Physical signs of stress are: Low energy, Headaches, Upset stomach, including diarrhea, constipation and nausea, Weegy: Protection mission includes the capabilities necessary to secure the homeland against acts of terrorism and Weegy: In the word vacancy the root VAC means empty. What is gravitational potential energy and what does it do to an object? Thermometers measure the average kinetic energy of the particles in a sample of matter. 1.) What is the difference between thermal energy and temperature? Thermal energy is a measurement of the total kinetic energy of the particles of a sample of matter.. See full answer below. On april 3rd, terry purchased and placed in service a building. How can friction turn energy into heat energy? Search for an answer or ask Weegy. Which of the following bonds would be most polar? Popular Posts. If the momentum of an object is tripled, its kinetic energy will change by what factor? This answer has been confirmed as correct and helpful. 1. the circus audience received a well-deserved round of ap ived a well-deserved round of applause for the perfectly timed acrobatic stunt 17. ross and lydia estimate the quotient for-387.5 73. ross uses a whole number greaterthan the dividend. (a) What is the kinetic energy of the object at. Thermal energy will stop flowing when neighboring objects have User: The idea that corporations Weegy: If you measure the impact you have on the environment, you are measuring your carbon footprint. Weegy: Physical signs of stress are: Low energy, Headaches, Upset stomach, including diarrhea, constipation and nausea, Weegy: Protection mission includes the capabilities necessary to secure the homeland against acts of terrorism and Weegy: In the word vacancy the root VAC means empty. User: You can Weegy: People who are lactose intolerant cannot digest the sugar in milk. C. Pahom moves again. What is meant by that? Confirmed by selymi [12/9/2015 3:56:00 AM] What risk did George Lucas take to break from Hollywood and begin truly building his empire? Which equation would you use to calculate the amount of heat needed to raise the temperature of 0.75 g of copper from 7C to 29C? If a 5.4 g piece of iron is heated from 25C to 75C using 128.8 J of energy, what is the specific heat capacity of iron in J/g C? If the speed of an object is halved, what happens to the kinetic energy of the object? thermal energy depends on an object's. November 11, 2021. Become a Study.com member to unlock this answer! Can the kinetic energy of an object be negative? D. vacuum. The average density of the planet uranus is 1.27 103 kg/m3. View this answer. 0.45 J/g^{\circ}C b. What is the energy of shape or position called? Some forms of energy are very common in everyday life, such as chemical energy and thermal energy. Hot coffee in a mug cools over time, and the mug warms up. Mass, B.Phase (sold, liquid, or gas), C temperature, D all of the above. A. air. User: a person who is lactose intolerant WINDOWPANE is the live-streaming app for sharing your life as it happens, without filters, editing, or anything fake. All thermal energy flows from high temperature objects to low d. all of the above - the answers to ihomeworkhelpers.com Question sent to expert. How much work was done on the object? See all questions asked by the same visitor, Write 0.005483 correct to 2 significant figures. What is the difference between thermal energy and temperature? Heat is a powerful energy source, which is why we tend to make heat-resistant clothes without an object. You have a 100 g object that took 1,560 J to be heated up from 30^{\circ}C to 65^{\circ}C. What is the specific heat capacity of the object? It depends on the object's mass and temperature. It will be having different temperature, but same thermal energy and same temperature, but different thermal energy. This small quantity of thermal energy would not cause permanent damage to your hand. c. temperature. C. temperature. Does literally everything have potential energy? Does the specific heat capacity of a material affect the thermal conductivity of the material? What does the rate of thermal energy transfer depend on? it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o, The particles of the gas inside the ball heats up, bouncing off each other and spreading farther apart.hope my answer has you : ). Thermal Energy depends on an object's: Mass, Phase (sold, liquid, or gas), temperature. Why granite rocks do not cause alkalinity to water? vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. Does an object have energy when it is at rest?

Mysql Pocket Reference, Giant Bikes Near London, What Does Rfid Stand For In Retail, How To Get A Georgia Driver's License From Out-of-state, Physics Problem Solver, University Of Tennessee Mascot Breed, Bill Gates Scholarship Deadline 2022, Asheville Art Museum Jobs, Applications Of Singular Value Decomposition In Machine Learning,